| Melting point |
22.92 °C |
| Density |
0.84 g/cm3 |
| storage temp. |
2-8°C |
| solubility |
Practically insoluble in water, freely soluble in anhydrous ethanol and in 2-propanol, practically insoluble in ethyl acetate. It is freely soluble in a 40 g/L solution of sodium hydroxide. |
| form |
suspension |
| pka |
6.6 |
| Appearance |
White to off-white Solid |
| Major Application |
pharmaceutical (small molecule) |
| InChI |
1S/C5H8O2.C4H6O2/c1-4(2)5(6)7-3;1-3(2)4(5)6/h1H2,2-3H3;1H2,2H3,(H,5,6) |
| InChIKey |
IWVKTOUOPHGZRX-UHFFFAOYSA-N |
| SMILES |
O(C)C(=O)C(=C)C.OC(=O)C(=C)C |
| EPA Substance Registry System |
Methyl methacrylate methacrylic acid polymer (25086-15-1) |
