1-Amino-1-cyclopropanecarbonitrile hydrochloride
- Product Name1-Amino-1-cyclopropanecarbonitrile hydrochloride
- CAS127946-77-4
- MFC4H7ClN2
- MW118.56
- EINECS629-718-8
- MOL File127946-77-4.mol
Chemical Properties
| Melting point | 223°C |
| Density | 1.244 at 20℃ |
| vapor pressure | 1.475hPa at 20℃ |
| storage temp. | Inert atmosphere,2-8°C |
| Water Solubility | Soluble in water |
| form | Powder |
| color | White to Almost white |
| InChI | InChI=1S/C4H6N2.ClH/c5-3-4(6)1-2-4;/h1-2,6H2;1H |
| InChIKey | PCEIEQLJYDMRFZ-UHFFFAOYSA-N |
| SMILES | C1(N)(CC1)C#N.Cl |
| LogP | 2.72 at 25℃ and pH5.5 |
| CAS DataBase Reference | 127946-77-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25-36-43 |
| Safety Statements | 26-36/37-45 |
| RIDADR | UN3439 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |