| Melting point |
66-70 °C (lit.) |
| Boiling point |
427.9±45.0 °C(Predicted) |
| Density |
1.178±0.06 g/cm3(Predicted) |
| vapor pressure |
0Pa at 25℃ |
| storage temp. |
under inert gas (nitrogen or Argon) at 2–8 °C |
| form |
powder to crystal |
| color |
Light yellow to Yellow to Orange |
| Water Solubility |
8μg/L at 25℃ |
| InChI |
InChI=1S/C17H16OS/c1-3-11-9-12(4-2)17-14(10-11)16(18)13-7-5-6-8-15(13)19-17/h5-10H,3-4H2,1-2H3 |
| InChIKey |
BTJPUDCSZVCXFQ-UHFFFAOYSA-N |
| SMILES |
C1(=O)C2=C(C=CC=C2)SC2=C1C=C(CC)C=C2CC |
| LogP |
6.5 at 20℃ |
| CAS DataBase Reference |
82799-44-8(CAS DataBase Reference) |
| EPA Substance Registry System |
9H-Thioxanthen-9-one, 2,4-diethyl- (82799-44-8) |
