Platinum-cyclovinylmethylsiloxane complex
- Product NamePlatinum-cyclovinylmethylsiloxane complex
- CAS68585-32-0
- MFC12H25Cl6O4PtSi4-
- MW753.45
- EINECS271-555-6
- MOL File68585-32-0.mol
Chemical Properties
| Boiling point | 207 °C |
| Density | 1.017 g/mL at 25 °C |
| Flash point | 234 °F |
| Specific Gravity | 1.017 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | 1S/C12H24O4Si4.Pt/c1-9-17(5)13-18(6,10-2)15-20(8,12-4)16-19(7,11-3)14-17;/h9-12H,1-4H2,5-8H3; |
| InChIKey | PIZSEPSUZMIOQF-UHFFFAOYSA-N |
| SMILES | [Pt].C[Si]1(O[Si](C)(O[Si](C)(O[Si](C)(O1)C=C)C=C)C=C)C=C |
| EPA Substance Registry System | Platinate(2-), hexachloro-, dihydrogen, (OC-6-11)-, reaction products with 2,4,6,8-tetraethenyl-2,4,6,8-tetramethylcyclotetrasiloxane (68585-32-0) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-42/43 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 28439000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Repr. 1B Resp. Sens. 1 |