Chemical Properties
| Melting point | 189-190 °C (dec.)(lit.) |
| Boiling point | 442.29°C (rough estimate) |
| Density | 1.1872 (rough estimate) |
| refractive index | 1.6400 (estimate) |
| solubility | almost transparency in Acetic acid |
| form | powder to crystal |
| pka | 10.34 ± 0.02(at 25℃) |
| color | Light yellow to Brown to Dark green |
| Merck | 14,6612 |
| BRN | 3913543 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C20H16N4/c1-4-10-17(11-5-1)21-20-22-24(19-14-8-3-9-15-19)16-23(20)18-12-6-2-7-13-18/h1-16H |
| InChIKey | CWGBFIRHYJNILV-UHFFFAOYSA-N |
| SMILES | [N+]1(=CN(C2C=CC=CC=2)[N-]/C/1=N\C1C=CC=CC=1)C1=CC=CC=C1 |
| EPA Substance Registry System | 1,4-Diphenyl-3-(phenylamino)-1H-1,2,4-triazolium inner salt (2218-94-2) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29339980 |
| Storage Class | 11 - Combustible Solids |