4-Bromo-2-methyl-6-nitroaniline
- Product Name4-Bromo-2-methyl-6-nitroaniline
- CAS77811-44-0
- MFC7H7BrN2O2
- MW231.05
- EINECS615-013-2
- MOL File77811-44-0.mol
Chemical Properties
| Melting point | 143-147 °C |
| Boiling point | 326.8±37.0 °C(Predicted) |
| Density | 1.7207 (rough estimate) |
| refractive index | 1.5150 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | -1.23±0.25(Predicted) |
| color | Light yellow to Brown |
| Water Solubility | Slightly soluble in water and soluble in hot methanol. |
| BRN | 3530524 |
| InChI | InChI=1S/C7H7BrN2O2/c1-4-2-5(8)3-6(7(4)9)10(11)12/h2-3H,9H2,1H3 |
| InChIKey | ZXFVKFUXKFPUQJ-UHFFFAOYSA-N |
| SMILES | C1(N)=C([N+]([O-])=O)C=C(Br)C=C1C |
| CAS DataBase Reference | 77811-44-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
