4-Bromo-2-thiophenecarboxylic acid
- Product Name4-Bromo-2-thiophenecarboxylic acid
- CAS16694-18-1
- MFC5H3BrO2S
- MW207.05
- EINECS679-544-1
- MOL File16694-18-1.mol
Chemical Properties
| Melting point | 121 °C |
| Boiling point | 323.7±27.0 °C(Predicted) |
| Density | 1.923±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to crystal |
| pka | 3.50±0.10(Predicted) |
| color | White to Light yellow |
| λmax | 245nm(EtOH)(lit.) |
| InChI | InChI=1S/C5H3BrO2S/c6-3-1-4(5(7)8)9-2-3/h1-2H,(H,7,8) |
| InChIKey | HJZFPRVFLBBAMU-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)SC=C(Br)C=1 |
| CAS DataBase Reference | 16694-18-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-26-36/37/39-37/39 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
