| Boiling point |
135-136 °C/20 mmHg (lit.) |
| Density |
0.93 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.443(lit.) |
| Flash point |
>230 °F |
| storage temp. |
−20°C |
| solubility |
Chloroform (Slightly), Methanol (Slightly) |
| form |
clear liquid |
| color |
Colorless to Light yellow to Light orange |
| Specific Gravity |
0.93 |
| Sensitive |
Moisture Sensitive |
| BRN |
1759226 |
| Stability |
Moisture Sensitive |
| InChI |
InChI=1S/C11H21ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2,1H3 |
| InChIKey |
JUKPJGZUFHCZQI-UHFFFAOYSA-N |
| SMILES |
C(Cl)(=O)CCCCCCCCCC |
| CAS DataBase Reference |
17746-05-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Undecanoyl chloride (17746-05-3) |
