4-Phenylimidazole
- Product Name4-Phenylimidazole
- CAS670-95-1
- MFC9H8N2
- MW144.17
- EINECS211-580-1
- MOL File670-95-1.mol
Chemical Properties
| Melting point | 128-131 °C (lit.) |
| Boiling point | 252.78°C (rough estimate) |
| Density | 1.1357 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | acetone: soluble25mg/mL, clear, colorless to yellow (typical) |
| form | powder to crystal |
| pka | 13.58±0.10(Predicted) |
| color | White to Orange to Green |
| BRN | 2969 |
| InChI | InChI=1S/C9H8N2/c1-2-4-8(5-3-1)9-6-10-7-11-9/h1-7H,(H,10,11) |
| InChIKey | XHLKOHSAWQPOFO-UHFFFAOYSA-N |
| SMILES | C1NC(C2=CC=CC=C2)=CN=1 |
| CAS DataBase Reference | 670-95-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |