4-(1H-Imidazol-1-yl)benzaldehyde
- Product Name4-(1H-Imidazol-1-yl)benzaldehyde
- CAS10040-98-9
- MFC10H8N2O
- MW172.18
- EINECS
- MOL File10040-98-9.mol
Chemical Properties
| Melting point | 153-155 °C(lit.) |
| Boiling point | 351.1±25.0 °C(Predicted) |
| Density | 1.15±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 5.07±0.10(Predicted) |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C10H8N2O/c13-7-9-1-3-10(4-2-9)12-6-5-11-8-12/h1-8H |
| InChIKey | DCICUQFMCRPKHZ-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(N2C=NC=C2)C=C1 |
| CAS DataBase Reference | 10040-98-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |