4,5-Diphenylimidazole
- Product Name4,5-Diphenylimidazole
- CAS668-94-0
- MFC15H12N2
- MW220.27
- EINECS211-573-3
- MOL File668-94-0.mol
Chemical Properties
| Melting point | 228-230 °C(lit.) |
| Boiling point | 351.21°C (rough estimate) |
| Density | 1.149 |
| refractive index | 1.5000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| pka | 12.99±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 157587 |
| InChI | 1S/C15H12N2/c1-3-7-12(8-4-1)14-15(17-11-16-14)13-9-5-2-6-10-13/h1-11H,(H,16,17) |
| InChIKey | CPHGOBGXZQKCKI-UHFFFAOYSA-N |
| SMILES | c1ccc(cc1)-c2nc[nH]c2-c3ccccc3 |
| CAS DataBase Reference | 668-94-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29332990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
