2,4,5-Triphenylimidazole
- Product Name2,4,5-Triphenylimidazole
- CAS484-47-9
- MFC21H16N2
- MW296.37
- EINECS207-606-6
- MOL File484-47-9.mol
Chemical Properties
| Melting point | 274-278 °C (lit.) |
| Boiling point | 427.96°C (rough estimate) |
| Density | 1.0874 (rough estimate) |
| refractive index | 1.8000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 11.66±0.10(Predicted) |
| color | White to Orange to Green |
| Water Solubility | Soluble in methanol. Insoluble in water. |
| λmax | 300nm(EtOH)(lit.) |
| BRN | 236652 |
| InChI | InChI=1S/C21H16N2/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)23-21(22-19)18-14-8-3-9-15-18/h1-15H,(H,22,23) |
| InChIKey | RNIPJYFZGXJSDD-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)NC(C2=CC=CC=C2)=C(C2=CC=CC=C2)N=1 |
| CAS DataBase Reference | 484-47-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Imidazole, 2,4,5-triphenyl- (484-47-9) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | NI8710000 |
| TSCA | Yes |
| HS Code | 29349990 |
