Benzamidoxime hydrochloride
- Product NameBenzamidoxime hydrochloride
- CAS613-92-3
- MFC7H8N2O
- MW136.15
- EINECS210-361-8
- MOL File613-92-3.mol
Chemical Properties
| Melting point | 77°C |
| Boiling point | 244℃ |
| Density | 1.18 |
| Flash point | 102℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | powder to crystal |
| pka | 6.85±0.69(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C7H8N2O/c8-7(9-10)6-4-2-1-3-5-6/h1-5,10H,(H2,8,9) |
| InChIKey | MXOQNVMDKHLYCZ-UHFFFAOYSA-N |
| SMILES | C1(C(NO)=N)=CC=CC=C1 |
| LogP | 1.024 |
| CAS DataBase Reference | 613-92-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,T |
| Risk Statements | 23/24/25-36/37/38-25-20/21/22 |
| Safety Statements | 22-36/37/39-45-26 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | CY6920000 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |