7-Dimethylamino-4-methylcoumarin
- Product Name7-Dimethylamino-4-methylcoumarin
- CAS87-01-4
- MFC12H13NO2
- MW203.24
- EINECS201-717-3
- MOL File87-01-4.mol
Chemical Properties
| Melting point | 144-146°C |
| Boiling point | 341.55°C (rough estimate) |
| Density | 1.1255 (rough estimate) |
| refractive index | 1.5260 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 1.91±0.20(Predicted) |
| color | White to Light yellow to Green |
| ex/em | λex 391 nm; λem 474 nm |
| InChI | InChI=1S/C12H13NO2/c1-8-6-12(14)15-11-7-9(13(2)3)4-5-10(8)11/h4-7H,1-3H3 |
| InChIKey | GZEYLLPOQRZUDF-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(N(C)C)=CC=C2C(C)=C1 |
| CAS DataBase Reference | 87-01-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Methyl-7-dimethylaminocoumarin(87-01-4) |
| EPA Substance Registry System | 2H-1-Benzopyran-2-one, 7-(dimethylamino)-4-methyl- (87-01-4) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-36/37/39-36-26 |
| RTECS | GN6650000 |
| TSCA | TSCA listed |
| HS Code | 2932.20.4500 |
| Toxicity | LD50 oral in mouse: 3890mg/kg |