| Melting point |
191-193°C |
| Density |
1.154 g/mL at 25 °C |
| vapor pressure |
0.001Pa at 20℃ |
| refractive index |
n20/D 1.4541 |
| Flash point |
>230 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Methanol (Slightly), Water (Sparingly) |
| form |
clear liquid |
| color |
Colorless to Light yellow |
| PH |
4.8 to 6.4(50g/L, 25℃) |
| Water Solubility |
835.2g/L at 20℃ |
| BRN |
6576172 |
| InChI |
InChI=1S/C6H15ClNO.ClH/c1-8(2,3)5-6(9)4-7;/h6,9H,4-5H2,1-3H3;1H/q+1;/p-1 |
| InChIKey |
CSPHGSFZFWKVDL-UHFFFAOYSA-M |
| SMILES |
[N+](C)(CC(O)CCl)(C)C.[Cl-] |
| LogP |
-1.5 at 25℃ |
| CAS DataBase Reference |
3327-22-8(CAS DataBase Reference) |
| EPA Substance Registry System |
3-Chloro-2-hydroxypropyltrimethyl ammonium chloride (3327-22-8) |
