3-Chloro-2-hydroxypropyltrimethyl ammonium chloride
- Product Name3-Chloro-2-hydroxypropyltrimethyl ammonium chloride
- CAS3327-22-8
- CBNumberCB5732995
- MFC6H15Cl2NO
- MW188.1
- EINECS222-048-3
- MDL NumberMFCD00055655
- MOL File3327-22-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 191-193°C |
| Density | 1.154 g/mL at 25 °C |
| vapor pressure | 0.001Pa at 20℃ |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Methanol (Slightly), Water (Sparingly) |
| form | clear liquid |
| color | Colorless to Light yellow |
| PH | 4.8 to 6.4(50g/L, 25℃) |
| Water Solubility | 835.2g/L at 20℃ |
| BRN | 6576172 |
| InChI | InChI=1S/C6H15ClNO.ClH/c1-8(2,3)5-6(9)4-7;/h6,9H,4-5H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | CSPHGSFZFWKVDL-UHFFFAOYSA-M |
| SMILES | [N+](C)(CC(O)CCl)(C)C.[Cl-] |
| LogP | -1.5 at 25℃ |
| CAS DataBase Reference | 3327-22-8(CAS DataBase Reference) |
| Indirect Additives used in Food Contact Substances | (3-CHLORO-2-HYDROXYPROPYL) TRIMETHYLAMMONIUM CHLORIDE |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H351-H412 | |||||||||
| Precautionary statements | P202-P273-P280-P308+P313-P405-P501 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 36/37/38-52/53-40 | |||||||||
| Safety Statements | 26-36-61-36/37 | |||||||||
| RIDADR | 2811 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | BP5275400 | |||||||||
| HS Code | 2923.90.0100 | |||||||||
| HazardClass | 6.1(b) | |||||||||
| PackingGroup | III | |||||||||
| Toxicity | LDLo subcutaneous in mouse: 500mg/kg | |||||||||
| NFPA 704: |
|
