2-Chloro-1,3-difluorobenzene
- Product Name2-Chloro-1,3-difluorobenzene
- CAS38361-37-4
- MFC6H3ClF2
- MW148.54
- EINECS233-305-4
- MOL File38361-37-4.mol
Chemical Properties
| Boiling point | 126-128 |
| Density | 1.37 |
| refractive index | 1.4780-1.4820 |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C6H3ClF2/c7-6-4(8)2-1-3-5(6)9/h1-3H |
| InChIKey | OTZQYBFTOANOJO-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(F)=C1Cl |
| CAS DataBase Reference | 38361-37-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | 1993 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 2903998090 |