1,2,3-Trifluorobenzene
- Product Name1,2,3-Trifluorobenzene
- CAS1489-53-8
- MFC6H3F3
- MW132.08
- EINECS
- MOL File1489-53-8.mol
Chemical Properties
| Boiling point | 94-95 °C (lit.) |
| Density | 1.28 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 25 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.280 |
| BRN | 1862388 |
| Stability | Stable. Highly flammable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C6H3F3/c7-4-2-1-3-5(8)6(4)9/h1-3H |
| InChIKey | AJKNNUJQFALRIK-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(F)=C1F |
| CAS DataBase Reference | 1489-53-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36/37/39-37/39-33-7/9 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |