1,3-Dichloro-2-fluorobenzene
- Product Name1,3-Dichloro-2-fluorobenzene
- CAS2268-05-5
- MFC6H3Cl2F
- MW164.99
- EINECS607-128-1
- MOL File2268-05-5.mol
Chemical Properties
| Melting point | 37-40 °C(lit.) |
| Boiling point | 168-169 °C(lit.) |
| Density | 1.3967 (estimate) |
| Flash point | 140 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| BRN | 1862513 |
| InChI | InChI=1S/C6H3Cl2F/c7-4-2-1-3-5(8)6(4)9/h1-3H |
| InChIKey | JORVCRLRRRRLFI-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=CC(Cl)=C1F |
| CAS DataBase Reference | 2268-05-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3-Dichloro-2-fluorobenzene(2268-05-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 2 |
| Hazard Note | Irritant |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 2903998090 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Flam. Sol. 2 Skin Irrit. 2 STOT SE 3 |
