2-Bromoquinoline
- Product Name2-Bromoquinoline
- CAS2005-43-8
- MFC9H6BrN
- MW208.05
- EINECS679-582-9
- MOL File2005-43-8.mol
Chemical Properties
| Melting point | 44-48 °C |
| Boiling point | 115°C/0.3mmHg(lit.) |
| Density | 1.564±0.06 g/cm3(Predicted) |
| Flash point | >110℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 0.58±0.40(Predicted) |
| color | White to Light yellow |
| λmax | 319nm(EtOH)(lit.) |
| InChI | InChI=1S/C9H6BrN/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H |
| InChIKey | QKJAZPHKNWSXDF-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C=CC=1Br |
| CAS DataBase Reference | 2005-43-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-41-37/38-22 |
| Safety Statements | 26-36-39-22 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |