2-Chloro-5-nitrobenzonitrile
- Product Name2-Chloro-5-nitrobenzonitrile
- CAS16588-02-6
- MFC7H3ClN2O2
- MW182.56
- EINECS240-643-6
- MOL File16588-02-6.mol
Chemical Properties
| Melting point | 105-107 °C (lit.) |
| Boiling point | 122 °C / 0.6mmHg |
| Density | 1.6133 (rough estimate) |
| refractive index | 1.5557 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 1818642 |
| InChI | InChI=1S/C7H3ClN2O2/c8-7-2-1-6(10(11)12)3-5(7)4-9/h1-3H |
| InChIKey | ZGILLTVEEBNDOB-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC([N+]([O-])=O)=CC=C1Cl |
| CAS DataBase Reference | 16588-02-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| RTECS | DI3040000 |
| HazardClass | IRRITANT |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |