| Melting point |
165-168 °C (lit.) |
| Boiling point |
356.5±27.0 °C(Predicted) |
| Density |
1.6 |
| refractive index |
1.6000 (estimate) |
| Flash point |
>100°C |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
3.6g/l |
| pka |
pK1: 2.17 (25°C) |
| form |
Crystalline Powder |
| color |
Light yellow to beige-brown |
| BRN |
1877474 |
| Henry's Law Constant |
6.5×103 mol/(m3Pa) at 25℃, Abraham and Jr. (2019) |
| InChI |
1S/C7H4ClNO4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,(H,10,11) |
| InChIKey |
QUEKGYQTRJVEQC-UHFFFAOYSA-N |
| SMILES |
OC(=O)c1cc(ccc1Cl)[N+]([O-])=O |
| CAS DataBase Reference |
2516-96-3(CAS DataBase Reference) |
| NIST Chemistry Reference |
2-Chloro-5-nitrobenzoic acid(2516-96-3) |
| EPA Substance Registry System |
Benzoic acid, 2-chloro-5-nitro- (2516-96-3) |