3,4,5-Trimethoxybenzonitrile
- Product Name3,4,5-Trimethoxybenzonitrile
- CAS1885-35-4
- MFC10H11NO3
- MW193.2
- EINECS217-550-4
- MOL File1885-35-4.mol
Chemical Properties
| Melting point | 91-94 °C (lit.) |
| Boiling point | 180-185 °C/10 mmHg (lit.) |
| Density | 1.2307 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| Flash point | 180-185°C/10mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 979686 |
| InChI | InChI=1S/C10H11NO3/c1-12-8-4-7(6-11)5-9(13-2)10(8)14-3/h4-5H,1-3H3 |
| InChIKey | OSBQUSPVORCDCU-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(OC)=C(OC)C(OC)=C1 |
| CAS DataBase Reference | 1885-35-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzonitrile, 3,4,5-trimethoxy-(1885-35-4) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-21/22 |
| Safety Statements | 26-37/39-36/37 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| RTECS | DI4965000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |