3-Methoxybenzonitrile
- Product Name3-Methoxybenzonitrile
- CAS1527-89-5
- MFC8H7NO
- MW133.15
- EINECS216-201-3
- MOL File1527-89-5.mol
Chemical Properties
| Melting point | 20-22°C |
| Boiling point | 111-112 °C13 mm Hg(lit.) |
| Density | 1.089 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 221 °F |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Slightly soluble in water |
| form | powder to lump to clear liquid |
| color | White or Colorles to Yellow to Orange |
| BRN | 1932666 |
| InChI | InChI=1S/C8H7NO/c1-10-8-4-2-3-7(5-8)6-9/h2-5H,1H3 |
| InChIKey | KLXSUMLEPNAZFK-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC(OC)=C1 |
| CAS DataBase Reference | 1527-89-5(CAS DataBase Reference) |
| NIST Chemistry Reference | m-Methoxybenzontrile(1527-89-5) |
| EPA Substance Registry System | Benzonitrile, 3-methoxy- (1527-89-5) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36/37-24/25 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
