| Melting point |
20-22°C |
| Boiling point |
111-112 °C13 mm Hg(lit.) |
| Density |
1.089 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.5402(lit.) |
| Flash point |
221 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| Water Solubility |
Slightly soluble in water |
| form |
powder to lump to clear liquid |
| color |
White or Colorles to Yellow to Orange |
| BRN |
1932666 |
| InChI |
InChI=1S/C8H7NO/c1-10-8-4-2-3-7(5-8)6-9/h2-5H,1H3 |
| InChIKey |
KLXSUMLEPNAZFK-UHFFFAOYSA-N |
| SMILES |
C(#N)C1=CC=CC(OC)=C1 |
| CAS DataBase Reference |
1527-89-5(CAS DataBase Reference) |
| NIST Chemistry Reference |
m-Methoxybenzontrile(1527-89-5) |
| EPA Substance Registry System |
Benzonitrile, 3-methoxy- (1527-89-5) |
