1,3-Dichloro-4-fluorobenzene
- Product Name1,3-Dichloro-4-fluorobenzene
- CAS1435-48-9
- MFC6H3Cl2F
- MW164.99
- EINECS406-160-1
- MOL File1435-48-9.mol
Chemical Properties
| Melting point | -23 °C |
| Boiling point | 172-174 °C(lit.) |
| Density | 1.409 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 98 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.409 |
| Water Solubility | insoluble |
| BRN | 2500791 |
| InChI | InChI=1S/C6H3Cl2F/c7-4-1-2-6(9)5(8)3-4/h1-3H |
| InChIKey | BDJZCCWUSOZUQG-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(Cl)C=C1Cl |
| CAS DataBase Reference | 1435-48-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3-Dichloro-4-fluorobenzene(1435-48-9) |
Safety Information
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 22-38-48/20/22-51/53-10-36/37/38 |
| Safety Statements | 36/37-61-16-36-26 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29039990 |