1-Phenyl-2-propanol
- Product Name1-Phenyl-2-propanol
- CAS14898-87-4
- MFC9H12O
- MW136.19
- EINECS691-119-2
- MOL File14898-87-4.mol
Chemical Properties
| Boiling point | 219-221 °C(lit.) |
| Density | 0.973 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 185 °F |
| form | Liquid |
| color | Clear colorless |
| Odor | Sweet and somewhat floral-green odour with a Honey-like undertone and moderate to poor tenacity. |
| InChI | InChI=1S/C9H12O/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3 |
| InChIKey | WYTRYIUQUDTGSX-UHFFFAOYSA-N |
| SMILES | C1(CC(O)C)=CC=CC=C1 |
| CAS DataBase Reference | 14898-87-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| RTECS | SG8589500 |
| HS Code | 29062900 |
