2-Indanol
- Product Name2-Indanol
- CAS4254-29-9
- MFC9H10O
- MW134.18
- EINECS224-230-8
- MOL File4254-29-9.mol
Chemical Properties
| Melting point | 68-71 °C (lit.) |
| Boiling point | 120-123 °C (12.0016 mmHg) |
| Density | 0.8540 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| Flash point | 109 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystaline |
| pka | 15.17±0.20(Predicted) |
| color | White to Light yellow |
| Water Solubility | 6 g/L (20 ºC) |
| BRN | 1862567 |
| InChI | InChI=1S/C9H10O/c10-9-5-7-3-1-2-4-8(7)6-9/h1-4,9-10H,5-6H2 |
| InChIKey | KMGCKSAIIHOKCX-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2)CC1O |
| CAS DataBase Reference | 4254-29-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Indanol(4254-29-9) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22-36 |
| Safety Statements | 37/39-26-36/37/39-27-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29062990 |
| Storage Class | 11 - Combustible Solids |
