4-Aminoisoquinoline
- Product Name4-Aminoisoquinoline
- CAS23687-25-4
- MFC9H8N2
- MW144.17
- EINECS245-823-8
- MOL File23687-25-4.mol
Chemical Properties
| Melting point | 108.0 to 112.0 °C |
| Boiling point | 360.0±17.0 °C(Predicted) |
| Density | 1.210±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 6.29±0.10(Predicted) |
| color | White to Brown |
| InChI | InChI=1S/C9H8N2/c10-9-6-11-5-7-3-1-2-4-8(7)9/h1-6H,10H2 |
| InChIKey | ISIUXVGHQFJYHM-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2)C(N)=CN=1 |
| CAS DataBase Reference | 23687-25-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933499090 |
