1-Aminoisoquinoline
- Product Name1-Aminoisoquinoline
- CAS1532-84-9
- MFC9H8N2
- MW144.17
- EINECS216-243-2
- MOL File1532-84-9.mol
Chemical Properties
| Melting point | 122-124 °C (lit.) |
| Boiling point | 166°C/8mmHg(lit.) |
| Density | 1.1148 (estimate) |
| refractive index | 1.7080 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | pK1: 7.62(+1) (20°C,μ=0.01) |
| color | Light yellow to Brown to Dark green |
| λmax | 335nm(H2O)(lit.) |
| InChI | InChI=1S/C9H8N2/c10-9-8-4-2-1-3-7(8)5-6-11-9/h1-6H,(H2,10,11) |
| InChIKey | OSILBMSORKFRTB-UHFFFAOYSA-N |
| SMILES | C1(N)C2=C(C=CC=C2)C=CN=1 |
| CAS DataBase Reference | 1532-84-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
