Pectolinarigenin
- Product NamePectolinarigenin
- CAS520-12-7
- MFC17H14O6
- MW314.29
- EINECS208-286-0
- MOL File520-12-7.mol
Chemical Properties
| Melting point | 220-223° |
| Boiling point | 565.5±50.0 °C(Predicted) |
| Density | 1.402±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 6.49±0.40(Predicted) |
| form | Solid |
| color | Light yellow to yellow |
| Major Application | food and beverages |
| InChI | 1S/C17H14O6/c1-21-10-5-3-9(4-6-10)13-7-11(18)15-14(23-13)8-12(19)17(22-2)16(15)20/h3-8,19-20H,1-2H3 |
| InChIKey | GPQLHGCIAUEJQK-UHFFFAOYSA-N |
| SMILES | [o]1c2c([c](cc1c3ccc(cc3)OC)=O)c(c(c(c2)O)OC)O |
| LogP | 2.640 (est) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
