| Melting point |
178-182 °C |
| Boiling point |
442.39°C (rough estimate) |
| alpha |
[α]D20 -79～-85° (c=2, H2O)(calculated on the dried basis) |
| Density |
1.3709 (rough estimate) |
| refractive index |
1.5200 (estimate) |
| storage temp. |
Inert atmosphere,Store in freezer, under -20°C |
| solubility |
DMF: 11 mg/ml; DMSO: 10 mg/ml; Ethanol: Slightly soluble; PBS (pH 7.2): 0.09 mg/ml |
| pka |
12.55±0.70(Predicted) |
| form |
powder to crystal |
| color |
White to Almost white |
| Water Solubility |
Soluble in DMSO, Methanol, Water. |
| BRN |
92213 |
| InChI |
1S/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-3-1-6(2-4-7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9+,10+,11-,12-/m1/s1 |
| InChIKey |
IFBHRQDFSNCLOZ-AUCPDYOHSA-N |
| SMILES |
OC[C@H]1O[C@@H](Oc2ccc(cc2)[N+]([O-])=O)[C@H](O)[C@@H](O)[C@H]1O |
| LogP |
-0.590 |
| CAS DataBase Reference |
3150-24-1(CAS DataBase Reference) |
