2-Phenylbenzimidazole-5-sulfonic acid
- Product Name2-Phenylbenzimidazole-5-sulfonic acid
- CAS27503-81-7
- MFC13H10N2O3S
- MW274.3
- EINECS248-502-0
- MOL File27503-81-7.mol
Chemical Properties
| Melting point | >300 °C (lit.) |
| Density | 1.3592 (rough estimate) |
| refractive index | 1.6360 (estimate) |
| storage temp. | 2-8°C |
| solubility | ethanol and water: soluble ((as sodium salt)) |
| form | Fine Crystalline Powder |
| pka | -0.87±0.40(Predicted) |
| color | White |
| Water Solubility | soluble |
| Merck | 14,3593 |
| BRN | 922664 |
| Stability | Hygroscopic |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| Cosmetics Ingredients Functions | UV FILTER LIGHT STABILIZER UV ABSORBER |
| InChI | 1S/C13H10N2O3S/c16-19(17,18)10-6-7-11-12(8-10)15-13(14-11)9-4-2-1-3-5-9/h1-8H,(H,14,15)(H,16,17,18) |
| InChIKey | UVCJGUGAGLDPAA-UHFFFAOYSA-N |
| SMILES | OS(=O)(=O)c1ccc2[nH]c(nc2c1)-c3ccccc3 |
| LogP | -1.42 at 25℃ |
Safety Information
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29339990 |
| Storage Class | 11 - Combustible Solids |