4-Nitro-1-naphthylamine
- Product Name4-Nitro-1-naphthylamine
- CAS776-34-1
- MFC10H8N2O2
- MW188.18
- EINECS212-277-7
- MOL File776-34-1.mol
Chemical Properties
| Melting point | 190-193 °C(lit.) |
| Boiling point | 419.0±25.0 °C(Predicted) |
| Density | 1.366±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 1.31±0.10(Predicted) |
| form | powder to crystal |
| color | Light yellow to Brown |
| BRN | 2211897 |
| InChI | 1S/C10H8N2O2/c11-9-5-6-10(12(13)14)8-4-2-1-3-7(8)9/h1-6H,11H2 |
| InChIKey | BVPJPRYNQHAOPQ-UHFFFAOYSA-N |
| SMILES | Nc1ccc([N+]([O-])=O)c2ccccc12 |
| CAS DataBase Reference | 776-34-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Naphthalenamine, 4-nitro-(776-34-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | QM4370000 |
| HS Code | 29214500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
