4-Nitro-1-naphthol
- Product Name4-Nitro-1-naphthol
- CAS605-62-9
- MFC10H7NO3
- MW189.17
- EINECS611-992-5
- MOL File605-62-9.mol
Chemical Properties
| Melting point | 165-168°C |
| Boiling point | 398.8±25.0 °C(Predicted) |
| Density | 1.413±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 6.22±0.40(Predicted) |
| color | Light yellow to Brown |
| BRN | 1959672 |
| InChI | InChI=1S/C10H7NO3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6,12H |
| InChIKey | AUIRNGLMBHIITH-UHFFFAOYSA-N |
| SMILES | C1(O)=C2C(C=CC=C2)=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 605-62-9(CAS DataBase Reference) |
Safety Information
| Risk Statements | 36/37/38-41 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 2811 |
| HazardClass | IRRITANT |
| HS Code | 29042090 |
