1-Nitronaphthalene
- Product Name1-Nitronaphthalene
- CAS86-57-7
- MFC10H7NO2
- MW173.17
- EINECS201-684-5
- MOL File86-57-7.mol
Chemical Properties
| Melting point | 56 °C |
| Boiling point | 304 °C(lit.) |
| Density | 1.223 g/mL at 25 °C(lit.) |
| refractive index | 1.5200 (estimate) |
| Flash point | 164 °C |
| storage temp. | 2-8°C |
| solubility | H2O: insoluble |
| form | solid |
| color | Light Yellow To Yellow |
| Specific Gravity | 1.223 |
| Water Solubility | 0.022 g/L |
| Merck | 14,6613 |
| BRN | 1867714 |
| Henry's Law Constant | 4.6×100 mol/(m3Pa) at 25℃, Chao et al. (2017) |
| Stability | Stable. Combustible. Incompatible with oxidizing agents, strong reducing agents. Mixtures with sulfuric or nitric acid are dangerous. |
| InChI | 1S/C10H7NO2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H |
| InChIKey | RJKGJBPXVHTNJL-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cccc2ccccc12 |
Safety Information
| Hazard Codes | F,T,N |
| Risk Statements | 11-25-51/53-40-36/37/38-23/24/25 |
| Safety Statements | 16-45-60-61-28A-36/37/39-26 |
| RIDADR | UN 2538 |
| WGK Germany | 2 |
| RTECS | QJ9720000 |
| Hazard Note | Flammable/Toxic |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29042000 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Flam. Sol. 2 |
| Hazardous Substances Data | 86-57-7(Hazardous Substances Data) |