Tryptamine hydrochloride
- Product NameTryptamine hydrochloride
- CAS343-94-2
- MFC10H13ClN2
- MW196.68
- EINECS206-446-4
- MOL File343-94-2.mol
Chemical Properties
| Melting point | 253-255 °C(lit.) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | water: soluble0.1g/10 mL, clear to slightly hazy, colorless to yellow |
| form | Powder |
| color | Beige to light orange |
| Water Solubility | water: soluble 0.1g/10 mL, clear to slightly hazy, colorless to yellow |
| Sensitive | Light Sensitive |
| Merck | 14,9796 |
| BRN | 3568419 |
| Stability | Hygroscopic |
| InChI | InChI=1S/C10H12N2.ClH/c11-6-5-8-7-12-10-4-2-1-3-9(8)10;/h1-4,7,12H,5-6,11H2;1H |
| InChIKey | KDFBGNBTTMPNIG-UHFFFAOYSA-N |
| SMILES | C12C=CC=CC=1NC=C2CCN.Cl |
| CAS DataBase Reference | 343-94-2(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Indole-3-ethanamine, monohydrochloride (343-94-2) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22-41-37/38-22 |
| Safety Statements | 22-24/25-36/37/39-36-26 |
| WGK Germany | 3 |
| RTECS | NL4375000 |
| F | 3-8-10 |
| TSCA | TSCA listed |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Sens. 1A |
