Potassium hydrogen 2-oxoglutarate
- Product NamePotassium hydrogen 2-oxoglutarate
- CAS997-43-3
- MFC5H5KO5
- MW184.19
- EINECS213-641-8
- MOL File997-43-3.mol
Chemical Properties
| Density | 1.74 g/cm3 |
| storage temp. | 2-8°C |
| solubility | water: 100 mg/mL, clear, colorless to faintly yellow |
| form | powder |
| color | White to off-white |
| Water Solubility | water: 100mg/mL, clear, colorless to faintly yellow |
| InChI | InChI=1S/C5H6O5.K/c6-3(5(9)10)1-2-4(7)8;/h1-2H2,(H,7,8)(H,9,10);/q;+1/p-1 |
| InChIKey | XTCZBVVKDHLWKU-UHFFFAOYSA-M |
| SMILES | [K+].C(O)(=O)C(=O)CCC([O-])=O |
| CAS DataBase Reference | 997-43-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 26-36/37/39-45 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
