Copper(II) ethylacetoacetate
- Product NameCopper(II) ethylacetoacetate
- CAS14284-06-1
- MFC12H18CuO6
- MW321.81
- EINECS238-181-5
- MOL File14284-06-1.mol
Chemical Properties
| Melting point | 192°C |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| solubility | Soluble in ethanol |
| form | Powder |
| color | green to blue |
| Water Solubility | soluble EtOH, chloroform [CRC10] |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: IDLH 100 mg/m3; TWA 1 mg/m3 |
| InChI | 1S/2C6H10O3.Cu/c2*1-3-5(4(2)7)6(8)9;/h2*5H,3H2,1-2H3,(H,8,9);/q;;+2/p-2 |
| InChIKey | BWRKZNDMFFOZJB-UHFFFAOYSA-L |
| SMILES | CCC(C(C)=O)C(=O)O[Cu]OC(=O)C(CC)C(C)=O |
| CAS DataBase Reference | 14284-06-1(CAS DataBase Reference) |
| EPA Substance Registry System | Copper, bis[ethyl 3-(oxo-.kappa.O)butanoato-.kappa.O']- (14284-06-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |