Copper(II) ethylacetoacetate
- Product NameCopper(II) ethylacetoacetate
- CAS14284-06-1
- CBNumberCB4179384
- MFC12H18CuO6
- MW321.81
- EINECS238-181-5
- MDL NumberMFCD00017759
- MOL File14284-06-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 192°C |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| solubility | Soluble in ethanol |
| form | Powder |
| color | green to blue |
| Water Solubility | soluble EtOH, chloroform [CRC10] |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: IDLH 100 mg/m3; TWA 1 mg/m3 |
| InChI | 1S/2C6H10O3.Cu/c2*1-3-5(4(2)7)6(8)9;/h2*5H,3H2,1-2H3,(H,8,9);/q;;+2/p-2 |
| InChIKey | BWRKZNDMFFOZJB-UHFFFAOYSA-L |
| SMILES | CCC(C(C)=O)C(=O)O[Cu]OC(=O)C(CC)C(C)=O |
| CAS DataBase Reference | 14284-06-1(CAS DataBase Reference) |
| EPA Substance Registry System | Copper, bis[ethyl 3-(oxo-.kappa.O)butanoato-.kappa.O']- (14284-06-1) |
| UNSPSC Code | 12161600 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|