14284-06-1
| Name | COPPER(II) ETHYLACETOACETATE |
| CAS | 14284-06-1 |
| EINECS(EC#) | 238-181-5 |
| Molecular Formula | C12H18CuO6 |
| MDL Number | MFCD00017759 |
| Molecular Weight | 321.81 |
| MOL File | 14284-06-1.mol |
Chemical Properties
| Appearance | Blue-green powder. Insoluble in water; soluble in most organic solvents. |
| Melting point | 192°C |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| solubility | Soluble in ethanol |
| form | Powder |
| color | green to blue |
| Water Solubility | soluble EtOH, chloroform [CRC10] |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: IDLH 100 mg/m3; TWA 1 mg/m3 |
| InChI | 1S/2C6H10O3.Cu/c2*1-3-5(4(2)7)6(8)9;/h2*5H,3H2,1-2H3,(H,8,9);/q;;+2/p-2 |
| InChIKey | BWRKZNDMFFOZJB-UHFFFAOYSA-L |
| SMILES | CCC(C(C)=O)C(=O)O[Cu]OC(=O)C(CC)C(C)=O |
| Uses | |
| CAS DataBase Reference | 14284-06-1(CAS DataBase Reference) |
| EPA Substance Registry System | Copper, bis[ethyl 3-(oxo-.kappa.O)butanoato-.kappa.O']- (14284-06-1) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |