| Melting point |
162-164 °C(lit.) |
| Boiling point |
363.4±34.0 °C(Predicted) |
| Density |
1.4042 (rough estimate) |
| refractive index |
1.6630 (estimate) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
DMSO (Slightly), Methanol (Slightly) |
| form |
powder to crystal |
| pka |
1.70±0.10(Predicted) |
| color |
White to Almost white |
| Water Solubility |
may decompose |
| λmax |
297nm(EtOH)(lit.) |
| Stability |
Hygroscopic |
| InChI |
InChI=1S/C8H11N3O3S/c1-3-14-7(12)6(11-13-2)5-4-15-8(9)10-5/h4H,3H2,1-2H3,(H2,9,10)/b11-6- |
| InChIKey |
POBMBNPEUPDXRS-WDZFZDKYSA-N |
| SMILES |
C(=N/OC)(/C(=O)OCC)\C1=CSC(N)=N1 |
| CAS DataBase Reference |
64485-88-7(CAS DataBase Reference) |
