Dorzolamide
- Product NameDorzolamide
- CAS120279-96-1
- MFC10H16N2O4S3
- MW324.44
- EINECS1533716-785-6
- MOL File120279-96-1.mol
Chemical Properties
| Boiling point | 575.8±60.0 °C(Predicted) |
| Density | 1.53±0.1 g/cm3(Predicted) |
| storage temp. | room temp |
| solubility | DMSO: soluble5mg/mL (clear solution, warmed) |
| pka | pKa 6.35 (Uncertain);8.50 (Uncertain) |
| form | powder |
| color | white to beige |
| optical activity | [α]/D -25 to -35°, c = 1 in methanol |
| InChI | 1S/C10H16N2O4S3/c1-3-12-8-4-6(2)18(13,14)10-7(8)5-9(17-10)19(11,15)16/h5-6,8,12H,3-4H2,1-2H3,(H2,11,15,16)/t6-,8-/m0/s1 |
| InChIKey | IAVUPMFITXYVAF-XPUUQOCRSA-N |
| SMILES | CCN[C@H]1C[C@H](C)S(=O)(=O)c2sc(cc12)S(N)(=O)=O |
| CAS DataBase Reference | 120279-96-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | XJ9095169 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
