| Melting point |
117-119°C |
| Boiling point |
389.26°C (rough estimate) |
| Density |
1.2430 (rough estimate) |
| refractive index |
1.4550 (estimate) |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
Soluble, 1mmol in 2mL DMF. Soluble in chloroform and methanol. |
| form |
Solid |
| pka |
3.84±0.10(Predicted) |
| color |
White to Off-White |
| optical activity |
Consistent with structure |
| BRN |
1981311 |
| Major Application |
peptide synthesis |
| InChI |
1S/C10H18N2O5/c1-10(2,3)17-9(16)12-6(8(14)15)4-5-7(11)13/h6H,4-5H2,1-3H3,(H2,11,13)(H,12,16)(H,14,15)/t6-/m1/s1 |
| InChIKey |
VVNYDCGZZSTUBC-ZCFIWIBFSA-N |
| SMILES |
CC(C)(C)OC(=O)N[C@H](CCC(N)=O)C(O)=O |
| CAS DataBase Reference |
61348-28-5(CAS DataBase Reference) |