Tantalum(V) butoxide
- Product NameTantalum(V) butoxide
- CAS51094-78-1
- MFC20H45O5Ta
- MW546.52
- EINECS256-962-9
- MOL File51094-78-1.mol
Chemical Properties
| Boiling point | 217°C 0,15mm |
| Density | 1.31 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 105 °F |
| form | liquid |
| Specific Gravity | 1.310 |
| color | colorless to light yellow |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | air sensitive, moisture sensitive |
| InChI | InChI=1S/5C4H9O.Ta/c5*1-2-3-4-5;/h5*2-4H2,1H3;/q5*-1;+5 |
| InChIKey | QORWLRPWMJEJKP-UHFFFAOYSA-N |
| SMILES | [Ta](OCCCC)(OCCCC)(OCCCC)(OCCCC)OCCCC |
| EPA Substance Registry System | 1-Butanol, tantalum(5+) salt (51094-78-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |