2-Methoxy-3-nitropyridine
- Product Name2-Methoxy-3-nitropyridine
- CAS20265-35-4
- MFC6H6N2O3
- MW154.12
- EINECS654-159-1
- MOL File20265-35-4.mol
Chemical Properties
| Melting point | 53-55°C |
| Boiling point | 247.9±20.0 °C(Predicted) |
| Density | 1.300±0.06 g/cm3(Predicted) |
| Flash point | >110℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | -0+-.0.10(Predicted) |
| color | White to Amber |
| BRN | 138199 |
| InChI | InChI=1S/C6H6N2O3/c1-11-6-5(8(9)10)3-2-4-7-6/h2-4H,1H3 |
| InChIKey | WZNQCVOSOCGWJG-UHFFFAOYSA-N |
| SMILES | C1(OC)=NC=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 20265-35-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22-41-37/38 |
| Safety Statements | 26-36/37/39-22-36-39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
