1,2-Bis(trimethylsilyloxy)cyclobutene
- Product Name1,2-Bis(trimethylsilyloxy)cyclobutene
- CAS17082-61-0
- MFC10H22O2Si2
- MW230.45
- EINECS
- MOL File17082-61-0.mol
Chemical Properties
| Boiling point | 58-59 °C2 mm Hg(lit.) |
| Density | 0.897 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 142 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | sol hydrocarbons and ethers. |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 0.87 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 1367530 |
| InChI | InChI=1S/C10H22O2Si2/c1-13(2,3)11-9-7-8-10(9)12-14(4,5)6/h7-8H2,1-6H3 |
| InChIKey | WOBRFSDEZREQAB-UHFFFAOYSA-N |
| SMILES | C1(O[Si](C)(C)C)CCC=1O[Si](C)(C)C |
| CAS DataBase Reference | 17082-61-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | No |
| HS Code | 2931.90.6000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
