2-(2-Pyridon-1-yl)-1,1,3,3-tetramethyluronium tetrafluoroborate
- Product Name2-(2-Pyridon-1-yl)-1,1,3,3-tetramethyluronium tetrafluoroborate
- CAS125700-71-2
- MFC10H16N3O2.BF4
- MW297.06
- EINECS
- MOL File125700-71-2.mol
Chemical Properties
| Melting point | 140 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | Soluble in water or 1% acetic acid |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | insoluble |
| Sensitive | Moisture Sensitive |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C10H16N3O2.BF4/c1-11(2)10(12(3)4)15-13-8-6-5-7-9(13)14;2-1(3,4)5/h5-8H,1-4H3;/q+1;-1 |
| InChIKey | HBQDCKPPSIWZLY-UHFFFAOYSA-M |
| SMILES | N1(C=CC=CC1=O)O/C(=[N+](/C)\C)/N(C)C.[B-](F)(F)(F)F |
| CAS DataBase Reference | 125700-71-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 37-36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-37/39-24/25 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Sens. 1A |
