2-(1-Oxy-pyridin-2-yl)-1,1,3,3-tetramethylisothiouronium tetrafluoroborate
- Product Name2-(1-Oxy-pyridin-2-yl)-1,1,3,3-tetramethylisothiouronium tetrafluoroborate
- CAS255825-38-8
- MFC10H17BF4N3OS*
- MW314.13
- EINECS
- MOL File255825-38-8.mol
Chemical Properties
| Melting point | 111-116 °C |
| storage temp. | −20°C |
| form | powder to crystal |
| color | White to Light yellow |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C10H16N3OS.BF4/c1-11(2)10(12(3)4)15-9-7-5-6-8-13(9)14;2-1(3,4)5/h5-8H,1-4H3;/q+1;-1 |
| InChIKey | LHLFXDQURZVFLK-UHFFFAOYSA-N |
| SMILES | C(/SC1=CC=CC=[N+]1[O-])(\N(C)C)=[N+](\C)/C.[B-](F)(F)(F)F |
| CAS DataBase Reference | 255825-38-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-60-37 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29333990 |