| Melting point |
124-126 °C (lit.) |
| Boiling point |
397.4±22.0 °C(Predicted) |
| Density |
1.375±0.06 g/cm3(Predicted) |
| storage temp. |
under inert gas (nitrogen or Argon) at 2-8°C |
| solubility |
It is soluble in organic solvents. |
| form |
Crystalline |
| pka |
4.02±0.10(Predicted) |
| color |
White to Light yellow to Light orange |
| Sensitive |
Hygroscopic |
| InChI |
InChI=1S/C12H7ClN2/c13-10-7-8-3-1-5-14-11(8)12-9(10)4-2-6-15-12/h1-7H |
| InChIKey |
XDUUQOQFSWSZSM-UHFFFAOYSA-N |
| SMILES |
N1C2C(=C(Cl)C=C3C=2N=CC=C3)C=CC=1 |
| CAS DataBase Reference |
4199-89-7(CAS DataBase Reference) |
| EPA Substance Registry System |
1,10-Phenanthroline, 5-chloro- (4199-89-7) |
