5-Chloro-1,10-phenanthroline
- Product Name5-Chloro-1,10-phenanthroline
- CAS4199-89-7
- CBNumberCB3333134
- MFC12H7ClN2
- MW214.65
- EINECS224-098-1
- MDL NumberMFCD00004980
- MOL File4199-89-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 124-126 °C (lit.) |
| Boiling point | 397.4±22.0 °C(Predicted) |
| Density | 1.375±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | It is soluble in organic solvents. |
| form | Crystalline |
| pka | 4.02±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C12H7ClN2/c13-10-7-8-3-1-5-14-11(8)12-9(10)4-2-6-15-12/h1-7H |
| InChIKey | XDUUQOQFSWSZSM-UHFFFAOYSA-N |
| SMILES | N1C2C(=C(Cl)C=C3C=2N=CC=C3)C=CC=1 |
| CAS DataBase Reference | 4199-89-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1,10-Phenanthroline, 5-chloro- (4199-89-7) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H318 | |||||||||
| Precautionary statements | P280-P305+P351+P338 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-41 | |||||||||
| Safety Statements | 26-39 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2933.49.7000 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 | |||||||||
| NFPA 704: |
|
